C9H10F3NO3 — CID 70588084
(2S)-1-[(E)-4,4,4-trifluorobut-2-enoyl]pyrrolidine-2-carboxylic acid (PubChem CID 70588084) has the molecular formula C9H10F3NO3 and a molecular weight of 237.18 g/mol. Its IUPAC name is (2S)-1-[(E)-4,4,4-trifluorobut-2-enoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[(E)-4,4,4-trifluorobut-2-enoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 70588084 |
| Molecular Formula | C9H10F3NO3 |
| Molecular Weight | 237.18 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | (2S)-1-[(E)-4,4,4-trifluorobut-2-enoyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCCN1C(=O)/C=C/C(F)(F)F |
| InChI | InChI=1S/C9H10F3NO3/c10-9(11,12)4-3-7(14)13-5-1-2-6(13)8(15)16/h3-4,6H,1-2,5H2,(H,15,16)/b4-3+/t6-/m0/s1 |
| InChIKey | FRBVLCHJXRAYMK-YUDCMIJISA-N |
| XLogP | 1.18 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.18 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|