About methyl 7-[(1S,2R)-2-(3-ethoxy-2-hydroxy-2-methylpropyl)sulfanyl-3-hydroxy-5-oxocyclopentyl]heptanoate
methyl 7-[(1S,2R)-2-(3-ethoxy-2-hydroxy-2-methylpropyl)sulfanyl-3-hydroxy-5-oxocyclopentyl]heptanoate (PubChem CID 70588563) has the molecular formula C19H34O6S
and a molecular weight of 390.54 g/mol. Its IUPAC name is methyl 7-[(1S,2R)-2-(3-ethoxy-2-hydroxy-2-methylpropyl)sulfanyl-3-hydroxy-5-oxocyclopentyl]heptanoate.
Molecular Properties
| Compound Name | methyl 7-[(1S,2R)-2-(3-ethoxy-2-hydroxy-2-methylpropyl)sulfanyl-3-hydroxy-5-oxocyclopentyl]heptanoate |
| PubChem CID | 70588563 |
| Molecular Formula | C19H34O6S |
| Molecular Weight | 390.54 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | methyl 7-[(1S,2R)-2-(3-ethoxy-2-hydroxy-2-methylpropyl)sulfanyl-3-hydroxy-5-oxocyclopentyl]heptanoate |
| SMILES | CCOCC(C)(O)CS[C@H]1C(O)CC(=O)[C@@H]1CCCCCCC(=O)OC |
| InChI | InChI=1S/C19H34O6S/c1-4-25-12-19(2,23)13-26-18-14(15(20)11-16(18)21)9-7-5-6-8-10-17(22)24-3/h14,16,18,21,23H,4-13H2,1-3H3/t14-,16?,18+,19?/m0/s1 |
| InChIKey | AWFSJZIXIXDZBB-ZUKISOHSSA-N |
| XLogP | 2.34 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.54 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 7-[(1S,2R)-2-(3-ethoxy-2-hydroxy-2-methylpropyl)sulfanyl-3-hydroxy-5-oxocyclopentyl]heptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 7-[(1S,2R)-2-(3-ethoxy-2-hydroxy-2-methylpropyl)sulfanyl-3-hydroxy-5-oxocyclopentyl]heptanoate?
The IUPAC name of methyl 7-[(1S,2R)-2-(3-ethoxy-2-hydroxy-2-methylpropyl)sulfanyl-3-hydroxy-5-oxocyclopentyl]heptanoate (CID 70588563) is methyl 7-[(1S,2R)-2-(3-ethoxy-2-hydroxy-2-methylpropyl)sulfanyl-3-hydroxy-5-oxocyclopentyl]heptanoate.
What is the SMILES notation for methyl 7-[(1S,2R)-2-(3-ethoxy-2-hydroxy-2-methylpropyl)sulfanyl-3-hydroxy-5-oxocyclopentyl]heptanoate?
The canonical SMILES for methyl 7-[(1S,2R)-2-(3-ethoxy-2-hydroxy-2-methylpropyl)sulfanyl-3-hydroxy-5-oxocyclopentyl]heptanoate is CCOCC(C)(O)CS[C@H]1C(O)CC(=O)[C@@H]1CCCCCCC(=O)OC.
What is the InChIKey of methyl 7-[(1S,2R)-2-(3-ethoxy-2-hydroxy-2-methylpropyl)sulfanyl-3-hydroxy-5-oxocyclopentyl]heptanoate?
The InChIKey is AWFSJZIXIXDZBB-ZUKISOHSSA-N. The full InChI is InChI=1S/C19H34O6S/c1-4-25-12-19(2,23)13-26-18-14(15(20)11-16(18)21)9-7-5-6-8-10-17(22)24-3/h14,16,18,21,23H,4-13H2,1-3H3/t14-,16?,18+,19?/m0/s1.
What are the key properties of methyl 7-[(1S,2R)-2-(3-ethoxy-2-hydroxy-2-methylpropyl)sulfanyl-3-hydroxy-5-oxocyclopentyl]heptanoate?
methyl 7-[(1S,2R)-2-(3-ethoxy-2-hydroxy-2-methylpropyl)sulfanyl-3-hydroxy-5-oxocyclopentyl]heptanoate has a molecular weight of 390.54 g/mol, XLogP of 2.34, 13 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7-[(1S,2R)-2-(3-ethoxy-2-hydroxy-2-methylpropyl)sulfanyl-3-hydroxy-5-oxocyclopentyl]heptanoate is sourced from PubChem (CID 70588563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).