About (3R,4S)-3,4-dimethyl-1-[2-(4-nitrophenyl)ethyl]-4-phenylpiperidine;hydrochloride
(3R,4S)-3,4-dimethyl-1-[2-(4-nitrophenyl)ethyl]-4-phenylpiperidine;hydrochloride (PubChem CID 70588703) has the molecular formula C21H27ClN2O2
and a molecular weight of 374.91 g/mol. Its IUPAC name is (3R,4S)-3,4-dimethyl-1-[2-(4-nitrophenyl)ethyl]-4-phenylpiperidine;hydrochloride.
Molecular Properties
| Compound Name | (3R,4S)-3,4-dimethyl-1-[2-(4-nitrophenyl)ethyl]-4-phenylpiperidine;hydrochloride |
| PubChem CID | 70588703 |
| Molecular Formula | C21H27ClN2O2 |
| Molecular Weight | 374.91 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | (3R,4S)-3,4-dimethyl-1-[2-(4-nitrophenyl)ethyl]-4-phenylpiperidine;hydrochloride |
| SMILES | C[C@H]1CN(CCc2ccc([N+](=O)[O-])cc2)CC[C@]1(C)c1ccccc1.Cl |
| InChI | InChI=1S/C21H26N2O2.ClH/c1-17-16-22(14-12-18-8-10-20(11-9-18)23(24)25)15-13-21(17,2)19-6-4-3-5-7-19;/h3-11,17H,12-16H2,1-2H3;1H/t17-,21-;/m0./s1 |
| InChIKey | FYBWTAZSGXIULC-PVMVIUQGSA-N |
| XLogP | 4.86 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.91 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3R,4S)-3,4-dimethyl-1-[2-(4-nitrophenyl)ethyl]-4-phenylpiperidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4S)-3,4-dimethyl-1-[2-(4-nitrophenyl)ethyl]-4-phenylpiperidine;hydrochloride?
The IUPAC name of (3R,4S)-3,4-dimethyl-1-[2-(4-nitrophenyl)ethyl]-4-phenylpiperidine;hydrochloride (CID 70588703) is (3R,4S)-3,4-dimethyl-1-[2-(4-nitrophenyl)ethyl]-4-phenylpiperidine;hydrochloride.
What is the SMILES notation for (3R,4S)-3,4-dimethyl-1-[2-(4-nitrophenyl)ethyl]-4-phenylpiperidine;hydrochloride?
The canonical SMILES for (3R,4S)-3,4-dimethyl-1-[2-(4-nitrophenyl)ethyl]-4-phenylpiperidine;hydrochloride is C[C@H]1CN(CCc2ccc([N+](=O)[O-])cc2)CC[C@]1(C)c1ccccc1.Cl.
What is the InChIKey of (3R,4S)-3,4-dimethyl-1-[2-(4-nitrophenyl)ethyl]-4-phenylpiperidine;hydrochloride?
The InChIKey is FYBWTAZSGXIULC-PVMVIUQGSA-N. The full InChI is InChI=1S/C21H26N2O2.ClH/c1-17-16-22(14-12-18-8-10-20(11-9-18)23(24)25)15-13-21(17,2)19-6-4-3-5-7-19;/h3-11,17H,12-16H2,1-2H3;1H/t17-,21-;/m0./s1.
What are the key properties of (3R,4S)-3,4-dimethyl-1-[2-(4-nitrophenyl)ethyl]-4-phenylpiperidine;hydrochloride?
(3R,4S)-3,4-dimethyl-1-[2-(4-nitrophenyl)ethyl]-4-phenylpiperidine;hydrochloride has a molecular weight of 374.91 g/mol, XLogP of 4.86, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4S)-3,4-dimethyl-1-[2-(4-nitrophenyl)ethyl]-4-phenylpiperidine;hydrochloride is sourced from PubChem (CID 70588703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).