C22H25Cl2N3O7 — CID 70588713
1-[[2-(2,4-dichlorophenyl)-4-[(3,5-dimethylphenoxy)methyl]-1,3-dioxolan-2-yl]methyl]imidazole;nitric acid;hydrate (PubChem CID 70588713) has the molecular formula C22H25Cl2N3O7 and a molecular weight of 514.36 g/mol. Its IUPAC name is 1-[[2-(2,4-dichlorophenyl)-4-[(3,5-dimethylphenoxy)methyl]-1,3-dioxolan-2-yl]methyl]imidazole;nitric acid;hydrate.
| Compound Name | 1-[[2-(2,4-dichlorophenyl)-4-[(3,5-dimethylphenoxy)methyl]-1,3-dioxolan-2-yl]methyl]imidazole;nitric acid;hydrate |
|---|---|
| PubChem CID | 70588713 |
| Molecular Formula | C22H25Cl2N3O7 |
| Molecular Weight | 514.36 g/mol |
| Exact Mass | 513.11 |
| IUPAC Name | 1-[[2-(2,4-dichlorophenyl)-4-[(3,5-dimethylphenoxy)methyl]-1,3-dioxolan-2-yl]methyl]imidazole;nitric acid;hydrate |
| SMILES | Cc1cc(C)cc(OCC2COC(Cn3ccnc3)(c3ccc(Cl)cc3Cl)O2)c1.O.O=[N+]([O-])O |
| InChI | InChI=1S/C22H22Cl2N2O3.HNO3.H2O/c1-15-7-16(2)9-18(8-15)27-11-19-12-28-22(29-19,13-26-6-5-25-14-26)20-4-3-17(23)10-21(20)24;2-1(3)4;/h3-10,14,19H,11-13H2,1-2H3;(H,2,3,4);1H2 |
| InChIKey | ZGNQVSLXGPLABG-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 140.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.36 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|