C16H25Cl2N3O3S — CID 70588785
(2S,5R)-6-(azepan-1-ylmethylideneamino)-2-(chloromethyl)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid;hydrochloride (PubChem CID 70588785) has the molecular formula C16H25Cl2N3O3S and a molecular weight of 410.37 g/mol. Its IUPAC name is (2S,5R)-6-(azepan-1-ylmethylideneamino)-2-(chloromethyl)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid;hydrochloride.
| Compound Name | (2S,5R)-6-(azepan-1-ylmethylideneamino)-2-(chloromethyl)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 70588785 |
| Molecular Formula | C16H25Cl2N3O3S |
| Molecular Weight | 410.37 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | (2S,5R)-6-(azepan-1-ylmethylideneamino)-2-(chloromethyl)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid;hydrochloride |
| SMILES | CC1(C)S[C@@H]2C(/N=C/N3CCCCCC3)C(=O)N2[C@@]1(CCl)C(=O)O.Cl |
| InChI | InChI=1S/C16H24ClN3O3S.ClH/c1-15(2)16(9-17,14(22)23)20-12(21)11(13(20)24-15)18-10-19-7-5-3-4-6-8-19;/h10-11,13H,3-9H2,1-2H3,(H,22,23);1H/b18-10+;/t11?,13-,16+;/m1./s1 |
| InChIKey | JEOTVVMPCJAGIG-KKTSDJJESA-N |
| XLogP | 2.44 |
| TPSA | 73.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.37 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|