About 1,2-oxazole-3-carboxylic acid;hydrochloride
1,2-oxazole-3-carboxylic acid;hydrochloride (PubChem CID 70588898) has the molecular formula C4H4ClNO3
and a molecular weight of 149.53 g/mol. Its IUPAC name is 1,2-oxazole-3-carboxylic acid;hydrochloride.
Molecular Properties
| Compound Name | 1,2-oxazole-3-carboxylic acid;hydrochloride |
| PubChem CID | 70588898 |
| Molecular Formula | C4H4ClNO3 |
| Molecular Weight | 149.53 g/mol |
| Exact Mass | 148.99 |
| IUPAC Name | 1,2-oxazole-3-carboxylic acid;hydrochloride |
| SMILES | Cl.O=C(O)c1ccon1 |
| InChI | InChI=1S/C4H3NO3.ClH/c6-4(7)3-1-2-8-5-3;/h1-2H,(H,6,7);1H |
| InChIKey | CRAXIUMHQIXMJX-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.53 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,2-oxazole-3-carboxylic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-oxazole-3-carboxylic acid;hydrochloride?
The IUPAC name of 1,2-oxazole-3-carboxylic acid;hydrochloride (CID 70588898) is 1,2-oxazole-3-carboxylic acid;hydrochloride.
What is the SMILES notation for 1,2-oxazole-3-carboxylic acid;hydrochloride?
The canonical SMILES for 1,2-oxazole-3-carboxylic acid;hydrochloride is Cl.O=C(O)c1ccon1.
What is the InChIKey of 1,2-oxazole-3-carboxylic acid;hydrochloride?
The InChIKey is CRAXIUMHQIXMJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3NO3.ClH/c6-4(7)3-1-2-8-5-3;/h1-2H,(H,6,7);1H.
What are the key properties of 1,2-oxazole-3-carboxylic acid;hydrochloride?
1,2-oxazole-3-carboxylic acid;hydrochloride has a molecular weight of 149.53 g/mol, XLogP of 0.79, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-oxazole-3-carboxylic acid;hydrochloride is sourced from PubChem (CID 70588898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).