C17H14ClNO2S — CID 70588927
2-[4-chloro-2-[4-(1-cyanoethyl)phenyl]sulfanylphenyl]acetic acid (PubChem CID 70588927) has the molecular formula C17H14ClNO2S and a molecular weight of 331.82 g/mol. Its IUPAC name is 2-[4-chloro-2-[4-(1-cyanoethyl)phenyl]sulfanylphenyl]acetic acid.
| Compound Name | 2-[4-chloro-2-[4-(1-cyanoethyl)phenyl]sulfanylphenyl]acetic acid |
|---|---|
| PubChem CID | 70588927 |
| Molecular Formula | C17H14ClNO2S |
| Molecular Weight | 331.82 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | 2-[4-chloro-2-[4-(1-cyanoethyl)phenyl]sulfanylphenyl]acetic acid |
| SMILES | CC(C#N)c1ccc(Sc2cc(Cl)ccc2CC(=O)O)cc1 |
| InChI | InChI=1S/C17H14ClNO2S/c1-11(10-19)12-3-6-15(7-4-12)22-16-9-14(18)5-2-13(16)8-17(20)21/h2-7,9,11H,8H2,1H3,(H,20,21) |
| InChIKey | CSTYWYXSLLVSGR-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.82 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |