About 4-imino-2-methylthieno[2,3-b]quinolizine-7-carboxamide
4-imino-2-methylthieno[2,3-b]quinolizine-7-carboxamide (PubChem CID 70589446) has the molecular formula C13H11N3OS
and a molecular weight of 257.32 g/mol. Its IUPAC name is 4-imino-2-methylthieno[2,3-b]quinolizine-7-carboxamide.
Molecular Properties
| Compound Name | 4-imino-2-methylthieno[2,3-b]quinolizine-7-carboxamide |
| PubChem CID | 70589446 |
| Molecular Formula | C13H11N3OS |
| Molecular Weight | 257.32 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | 4-imino-2-methylthieno[2,3-b]quinolizine-7-carboxamide |
| SMILES | [H]/N=c1\c2cc(C)sc2cc2ccc(C(N)=O)cn12 |
| InChI | InChI=1S/C13H11N3OS/c1-7-4-10-11(18-7)5-9-3-2-8(13(15)17)6-16(9)12(10)14/h2-6,14H,1H3,(H2,15,17)/b14-12+ |
| InChIKey | UXOPSLQXZKHBQY-WYMLVPIESA-N |
| XLogP | 2.04 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.32 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-imino-2-methylthieno[2,3-b]quinolizine-7-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-imino-2-methylthieno[2,3-b]quinolizine-7-carboxamide?
The IUPAC name of 4-imino-2-methylthieno[2,3-b]quinolizine-7-carboxamide (CID 70589446) is 4-imino-2-methylthieno[2,3-b]quinolizine-7-carboxamide.
What is the SMILES notation for 4-imino-2-methylthieno[2,3-b]quinolizine-7-carboxamide?
The canonical SMILES for 4-imino-2-methylthieno[2,3-b]quinolizine-7-carboxamide is [H]/N=c1\c2cc(C)sc2cc2ccc(C(N)=O)cn12.
What is the InChIKey of 4-imino-2-methylthieno[2,3-b]quinolizine-7-carboxamide?
The InChIKey is UXOPSLQXZKHBQY-WYMLVPIESA-N. The full InChI is InChI=1S/C13H11N3OS/c1-7-4-10-11(18-7)5-9-3-2-8(13(15)17)6-16(9)12(10)14/h2-6,14H,1H3,(H2,15,17)/b14-12+.
What are the key properties of 4-imino-2-methylthieno[2,3-b]quinolizine-7-carboxamide?
4-imino-2-methylthieno[2,3-b]quinolizine-7-carboxamide has a molecular weight of 257.32 g/mol, XLogP of 2.04, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-imino-2-methylthieno[2,3-b]quinolizine-7-carboxamide is sourced from PubChem (CID 70589446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).