About 4-[[(3R)-1,1-dioxothiolan-3-yl]amino]butanoic acid
4-[[(3R)-1,1-dioxothiolan-3-yl]amino]butanoic acid (PubChem CID 7058947) has the molecular formula C8H15NO4S
and a molecular weight of 221.28 g/mol. Its IUPAC name is 4-[[(3R)-1,1-dioxothiolan-3-yl]amino]butanoic acid.
Molecular Properties
| Compound Name | 4-[[(3R)-1,1-dioxothiolan-3-yl]amino]butanoic acid |
| PubChem CID | 7058947 |
| Molecular Formula | C8H15NO4S |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 4-[[(3R)-1,1-dioxothiolan-3-yl]amino]butanoic acid |
| SMILES | O=C(O)CCCN[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H15NO4S/c10-8(11)2-1-4-9-7-3-5-14(12,13)6-7/h7,9H,1-6H2,(H,10,11)/t7-/m1/s1 |
| InChIKey | LOYVVYSXUYAYIB-SSDOTTSWSA-N |
| XLogP | -0.37 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[[(3R)-1,1-dioxothiolan-3-yl]amino]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(3R)-1,1-dioxothiolan-3-yl]amino]butanoic acid?
The IUPAC name of 4-[[(3R)-1,1-dioxothiolan-3-yl]amino]butanoic acid (CID 7058947) is 4-[[(3R)-1,1-dioxothiolan-3-yl]amino]butanoic acid.
What is the SMILES notation for 4-[[(3R)-1,1-dioxothiolan-3-yl]amino]butanoic acid?
The canonical SMILES for 4-[[(3R)-1,1-dioxothiolan-3-yl]amino]butanoic acid is O=C(O)CCCN[C@@H]1CCS(=O)(=O)C1.
What is the InChIKey of 4-[[(3R)-1,1-dioxothiolan-3-yl]amino]butanoic acid?
The InChIKey is LOYVVYSXUYAYIB-SSDOTTSWSA-N. The full InChI is InChI=1S/C8H15NO4S/c10-8(11)2-1-4-9-7-3-5-14(12,13)6-7/h7,9H,1-6H2,(H,10,11)/t7-/m1/s1.
What are the key properties of 4-[[(3R)-1,1-dioxothiolan-3-yl]amino]butanoic acid?
4-[[(3R)-1,1-dioxothiolan-3-yl]amino]butanoic acid has a molecular weight of 221.28 g/mol, XLogP of -0.37, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(3R)-1,1-dioxothiolan-3-yl]amino]butanoic acid is sourced from PubChem (CID 7058947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).