About [(3S)-3-methyl-1,1-dioxothiolan-3-yl]-prop-2-enylazanium
[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-prop-2-enylazanium (PubChem CID 7058950) has the molecular formula C8H16NO2S+
and a molecular weight of 190.29 g/mol. Its IUPAC name is [(3S)-3-methyl-1,1-dioxothiolan-3-yl]-prop-2-enylazanium.
Molecular Properties
| Compound Name | [(3S)-3-methyl-1,1-dioxothiolan-3-yl]-prop-2-enylazanium |
| PubChem CID | 7058950 |
| Molecular Formula | C8H16NO2S+ |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | [(3S)-3-methyl-1,1-dioxothiolan-3-yl]-prop-2-enylazanium |
| SMILES | C=CC[NH2+][C@@]1(C)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H15NO2S/c1-3-5-9-8(2)4-6-12(10,11)7-8/h3,9H,1,4-7H2,2H3/p+1/t8-/m0/s1 |
| InChIKey | ORJPJRJOQNUOPX-QMMMGPOBSA-O |
| XLogP | -0.69 |
| TPSA | 50.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(3S)-3-methyl-1,1-dioxothiolan-3-yl]-prop-2-enylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S)-3-methyl-1,1-dioxothiolan-3-yl]-prop-2-enylazanium?
The IUPAC name of [(3S)-3-methyl-1,1-dioxothiolan-3-yl]-prop-2-enylazanium (CID 7058950) is [(3S)-3-methyl-1,1-dioxothiolan-3-yl]-prop-2-enylazanium.
What is the SMILES notation for [(3S)-3-methyl-1,1-dioxothiolan-3-yl]-prop-2-enylazanium?
The canonical SMILES for [(3S)-3-methyl-1,1-dioxothiolan-3-yl]-prop-2-enylazanium is C=CC[NH2+][C@@]1(C)CCS(=O)(=O)C1.
What is the InChIKey of [(3S)-3-methyl-1,1-dioxothiolan-3-yl]-prop-2-enylazanium?
The InChIKey is ORJPJRJOQNUOPX-QMMMGPOBSA-O. The full InChI is InChI=1S/C8H15NO2S/c1-3-5-9-8(2)4-6-12(10,11)7-8/h3,9H,1,4-7H2,2H3/p+1/t8-/m0/s1.
What are the key properties of [(3S)-3-methyl-1,1-dioxothiolan-3-yl]-prop-2-enylazanium?
[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-prop-2-enylazanium has a molecular weight of 190.29 g/mol, XLogP of -0.69, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S)-3-methyl-1,1-dioxothiolan-3-yl]-prop-2-enylazanium is sourced from PubChem (CID 7058950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).