C10H16O2 — CID 70589674
(3aS,7aS)-3a-hydroxy-7a-methyl-1,2,3,4,6,7-hexahydroinden-5-one (PubChem CID 70589674) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is (3aS,7aS)-3a-hydroxy-7a-methyl-1,2,3,4,6,7-hexahydroinden-5-one.
| Compound Name | (3aS,7aS)-3a-hydroxy-7a-methyl-1,2,3,4,6,7-hexahydroinden-5-one |
|---|---|
| PubChem CID | 70589674 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | (3aS,7aS)-3a-hydroxy-7a-methyl-1,2,3,4,6,7-hexahydroinden-5-one |
| SMILES | C[C@@]12CCC[C@]1(O)CC(=O)CC2 |
| InChI | InChI=1S/C10H16O2/c1-9-4-2-5-10(9,12)7-8(11)3-6-9/h12H,2-7H2,1H3/t9-,10-/m0/s1 |
| InChIKey | POTDAYSTPPZOCL-UWVGGRQHSA-N |
| XLogP | 1.66 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |