About (3-fluorophenyl)carbamic acid;hydrochloride
(3-fluorophenyl)carbamic acid;hydrochloride (PubChem CID 70589934) has the molecular formula C7H7ClFNO2
and a molecular weight of 191.59 g/mol. Its IUPAC name is (3-fluorophenyl)carbamic acid;hydrochloride.
Molecular Properties
| Compound Name | (3-fluorophenyl)carbamic acid;hydrochloride |
| PubChem CID | 70589934 |
| Molecular Formula | C7H7ClFNO2 |
| Molecular Weight | 191.59 g/mol |
| Exact Mass | 191.01 |
| IUPAC Name | (3-fluorophenyl)carbamic acid;hydrochloride |
| SMILES | Cl.O=C(O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C7H6FNO2.ClH/c8-5-2-1-3-6(4-5)9-7(10)11;/h1-4,9H,(H,10,11);1H |
| InChIKey | VKLYCFWCOITPGJ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.59 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3-fluorophenyl)carbamic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-fluorophenyl)carbamic acid;hydrochloride?
The IUPAC name of (3-fluorophenyl)carbamic acid;hydrochloride (CID 70589934) is (3-fluorophenyl)carbamic acid;hydrochloride.
What is the SMILES notation for (3-fluorophenyl)carbamic acid;hydrochloride?
The canonical SMILES for (3-fluorophenyl)carbamic acid;hydrochloride is Cl.O=C(O)Nc1cccc(F)c1.
What is the InChIKey of (3-fluorophenyl)carbamic acid;hydrochloride?
The InChIKey is VKLYCFWCOITPGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6FNO2.ClH/c8-5-2-1-3-6(4-5)9-7(10)11;/h1-4,9H,(H,10,11);1H.
What are the key properties of (3-fluorophenyl)carbamic acid;hydrochloride?
(3-fluorophenyl)carbamic acid;hydrochloride has a molecular weight of 191.59 g/mol, XLogP of 2.34, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3-fluorophenyl)carbamic acid;hydrochloride is sourced from PubChem (CID 70589934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).