C23H30ClNO3 — CID 70590031
[3-[(4-chlorophenyl)methyl]pyrrol-1-yl]methyl 2,2-dimethyl-3-pentoxycyclopropane-1-carboxylate (PubChem CID 70590031) has the molecular formula C23H30ClNO3 and a molecular weight of 403.95 g/mol. Its IUPAC name is [3-[(4-chlorophenyl)methyl]pyrrol-1-yl]methyl 2,2-dimethyl-3-pentoxycyclopropane-1-carboxylate.
| Compound Name | [3-[(4-chlorophenyl)methyl]pyrrol-1-yl]methyl 2,2-dimethyl-3-pentoxycyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 70590031 |
| Molecular Formula | C23H30ClNO3 |
| Molecular Weight | 403.95 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | [3-[(4-chlorophenyl)methyl]pyrrol-1-yl]methyl 2,2-dimethyl-3-pentoxycyclopropane-1-carboxylate |
| SMILES | CCCCCOC1C(C(=O)OCn2ccc(Cc3ccc(Cl)cc3)c2)C1(C)C |
| InChI | InChI=1S/C23H30ClNO3/c1-4-5-6-13-27-21-20(23(21,2)3)22(26)28-16-25-12-11-18(15-25)14-17-7-9-19(24)10-8-17/h7-12,15,20-21H,4-6,13-14,16H2,1-3H3 |
| InChIKey | YZDHVMHSPJLQGD-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.95 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|