About bis((E)-but-2-enoic acid);1-piperidin-1-ylethanone
bis((E)-but-2-enoic acid);1-piperidin-1-ylethanone (PubChem CID 70590123) has the molecular formula C15H25NO5
and a molecular weight of 299.37 g/mol. Its IUPAC name is bis((E)-but-2-enoic acid);1-piperidin-1-ylethanone.
Molecular Properties
| Compound Name | bis((E)-but-2-enoic acid);1-piperidin-1-ylethanone |
| PubChem CID | 70590123 |
| Molecular Formula | C15H25NO5 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | bis((E)-but-2-enoic acid);1-piperidin-1-ylethanone |
| SMILES | C/C=C/C(=O)O.C/C=C/C(=O)O.CC(=O)N1CCCCC1 |
| InChI | InChI=1S/C7H13NO.2C4H6O2/c1-7(9)8-5-3-2-4-6-8;2*1-2-3-4(5)6/h2-6H2,1H3;2*2-3H,1H3,(H,5,6)/b;2*3-2+ |
| InChIKey | XALGSBBQVXDKIK-XOFQDGEKSA-N |
| XLogP | 2.31 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze bis((E)-but-2-enoic acid);1-piperidin-1-ylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis((E)-but-2-enoic acid);1-piperidin-1-ylethanone?
The IUPAC name of bis((E)-but-2-enoic acid);1-piperidin-1-ylethanone (CID 70590123) is bis((E)-but-2-enoic acid);1-piperidin-1-ylethanone.
What is the SMILES notation for bis((E)-but-2-enoic acid);1-piperidin-1-ylethanone?
The canonical SMILES for bis((E)-but-2-enoic acid);1-piperidin-1-ylethanone is C/C=C/C(=O)O.C/C=C/C(=O)O.CC(=O)N1CCCCC1.
What is the InChIKey of bis((E)-but-2-enoic acid);1-piperidin-1-ylethanone?
The InChIKey is XALGSBBQVXDKIK-XOFQDGEKSA-N. The full InChI is InChI=1S/C7H13NO.2C4H6O2/c1-7(9)8-5-3-2-4-6-8;2*1-2-3-4(5)6/h2-6H2,1H3;2*2-3H,1H3,(H,5,6)/b;2*3-2+.
What are the key properties of bis((E)-but-2-enoic acid);1-piperidin-1-ylethanone?
bis((E)-but-2-enoic acid);1-piperidin-1-ylethanone has a molecular weight of 299.37 g/mol, XLogP of 2.31, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis((E)-but-2-enoic acid);1-piperidin-1-ylethanone is sourced from PubChem (CID 70590123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).