C27H30Cl4O3 — CID 70590131
bis[5,6-dichloro-1-(cyclohexen-1-yl)-4-methoxycyclohexa-2,4-dien-1-yl]methanone (PubChem CID 70590131) has the molecular formula C27H30Cl4O3 and a molecular weight of 544.35 g/mol. Its IUPAC name is bis[5,6-dichloro-1-(cyclohexen-1-yl)-4-methoxycyclohexa-2,4-dien-1-yl]methanone.
| Compound Name | bis[5,6-dichloro-1-(cyclohexen-1-yl)-4-methoxycyclohexa-2,4-dien-1-yl]methanone |
|---|---|
| PubChem CID | 70590131 |
| Molecular Formula | C27H30Cl4O3 |
| Molecular Weight | 544.35 g/mol |
| Exact Mass | 542.09 |
| IUPAC Name | bis[5,6-dichloro-1-(cyclohexen-1-yl)-4-methoxycyclohexa-2,4-dien-1-yl]methanone |
| SMILES | COC1=C(Cl)C(Cl)C(C(=O)C2(C3=CCCCC3)C=CC(OC)=C(Cl)C2Cl)(C2=CCCCC2)C=C1 |
| InChI | InChI=1S/C27H30Cl4O3/c1-33-19-13-15-26(23(30)21(19)28,17-9-5-3-6-10-17)25(32)27(18-11-7-4-8-12-18)16-14-20(34-2)22(29)24(27)31/h9,11,13-16,23-24H,3-8,10,12H2,1-2H3 |
| InChIKey | KEXDHIPTDYPMNL-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.35 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|