C23H36O6 — CID 70590140
methyl (Z)-2-acetyloxy-7-[(1R,2R)-2-[(E)-6-methoxy-4-methylhex-1-enyl]-5-oxocyclopentyl]hept-2-enoate (PubChem CID 70590140) has the molecular formula C23H36O6 and a molecular weight of 408.54 g/mol. Its IUPAC name is methyl (Z)-2-acetyloxy-7-[(1R,2R)-2-[(E)-6-methoxy-4-methylhex-1-enyl]-5-oxocyclopentyl]hept-2-enoate.
| Compound Name | methyl (Z)-2-acetyloxy-7-[(1R,2R)-2-[(E)-6-methoxy-4-methylhex-1-enyl]-5-oxocyclopentyl]hept-2-enoate |
|---|---|
| PubChem CID | 70590140 |
| Molecular Formula | C23H36O6 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | methyl (Z)-2-acetyloxy-7-[(1R,2R)-2-[(E)-6-methoxy-4-methylhex-1-enyl]-5-oxocyclopentyl]hept-2-enoate |
| SMILES | COCCC(C)C/C=C/[C@H]1CCC(=O)[C@@H]1CCCC/C=C(\OC(C)=O)C(=O)OC |
| InChI | InChI=1S/C23H36O6/c1-17(15-16-27-3)9-8-10-19-13-14-21(25)20(19)11-6-5-7-12-22(23(26)28-4)29-18(2)24/h8,10,12,17,19-20H,5-7,9,11,13-16H2,1-4H3/b10-8+,22-12-/t17?,19-,20+/m0/s1 |
| InChIKey | QCUKJNDOGDUEDF-MJNNICMOSA-N |
| XLogP | 4.38 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|