C23H30O7 — CID 70590318
7-[(1R,2R,3R)-2-[(E,3R)-3-(4H-1,3-benzodioxin-2-yl)-3-hydroxyprop-1-enyl]-3-hydroxy-5-oxocyclopentyl]heptanoic acid (PubChem CID 70590318) has the molecular formula C23H30O7 and a molecular weight of 418.49 g/mol. Its IUPAC name is 7-[(1R,2R,3R)-2-[(E,3R)-3-(4H-1,3-benzodioxin-2-yl)-3-hydroxyprop-1-enyl]-3-hydroxy-5-oxocyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R,2R,3R)-2-[(E,3R)-3-(4H-1,3-benzodioxin-2-yl)-3-hydroxyprop-1-enyl]-3-hydroxy-5-oxocyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 70590318 |
| Molecular Formula | C23H30O7 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | 7-[(1R,2R,3R)-2-[(E,3R)-3-(4H-1,3-benzodioxin-2-yl)-3-hydroxyprop-1-enyl]-3-hydroxy-5-oxocyclopentyl]heptanoic acid |
| SMILES | O=C(O)CCCCCC[C@H]1C(=O)C[C@@H](O)[C@@H]1/C=C/[C@@H](O)C1OCc2ccccc2O1 |
| InChI | InChI=1S/C23H30O7/c24-18(23-29-14-15-7-5-6-9-21(15)30-23)12-11-17-16(19(25)13-20(17)26)8-3-1-2-4-10-22(27)28/h5-7,9,11-12,16-18,20,23-24,26H,1-4,8,10,13-14H2,(H,27,28)/b12-11+/t16-,17-,18-,20-,23?/m1/s1 |
| InChIKey | VICVSOAIHDGWIC-MUSXQXDUSA-N |
| XLogP | 2.83 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|