C19H25NO2 — CID 70590320
ethyl (1S,14R)-10,11-dimethyl-10-azatetracyclo[9.3.1.02,7.09,14]pentadeca-2,4,6-triene-12-carboxylate (PubChem CID 70590320) has the molecular formula C19H25NO2 and a molecular weight of 299.41 g/mol. Its IUPAC name is ethyl (1S,14R)-10,11-dimethyl-10-azatetracyclo[9.3.1.02,7.09,14]pentadeca-2,4,6-triene-12-carboxylate.
| Compound Name | ethyl (1S,14R)-10,11-dimethyl-10-azatetracyclo[9.3.1.02,7.09,14]pentadeca-2,4,6-triene-12-carboxylate |
|---|---|
| PubChem CID | 70590320 |
| Molecular Formula | C19H25NO2 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | ethyl (1S,14R)-10,11-dimethyl-10-azatetracyclo[9.3.1.02,7.09,14]pentadeca-2,4,6-triene-12-carboxylate |
| SMILES | CCOC(=O)C1C[C@H]2C3Cc4ccccc4[C@H]2CC1(C)N3C |
| InChI | InChI=1S/C19H25NO2/c1-4-22-18(21)16-10-14-15-11-19(16,2)20(3)17(14)9-12-7-5-6-8-13(12)15/h5-8,14-17H,4,9-11H2,1-3H3/t14-,15-,16?,17?,19?/m1/s1 |
| InChIKey | PVZJAVCBLJQCKW-YCTIJVIUSA-N |
| XLogP | 2.99 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |