C9H13NO — CID 70590430
5,6,7,8-tetrahydro-1H-isochromen-5-amine (PubChem CID 70590430) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is 5,6,7,8-tetrahydro-1H-isochromen-5-amine.
| Compound Name | 5,6,7,8-tetrahydro-1H-isochromen-5-amine |
|---|---|
| PubChem CID | 70590430 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | 5,6,7,8-tetrahydro-1H-isochromen-5-amine |
| SMILES | NC1CCCC2=C1C=COC2 |
| InChI | InChI=1S/C9H13NO/c10-9-3-1-2-7-6-11-5-4-8(7)9/h4-5,9H,1-3,6,10H2 |
| InChIKey | NWJZTATWSLYDLB-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |