C19H26ClN — CID 70590551
(1R)-1-ethyl-10,11-dimethyl-10-azatetracyclo[10.2.2.02,7.09,14]hexadeca-2,4,6,15-tetraene;hydrochloride (PubChem CID 70590551) has the molecular formula C19H26ClN and a molecular weight of 303.88 g/mol. Its IUPAC name is (1R)-1-ethyl-10,11-dimethyl-10-azatetracyclo[10.2.2.02,7.09,14]hexadeca-2,4,6,15-tetraene;hydrochloride.
| Compound Name | (1R)-1-ethyl-10,11-dimethyl-10-azatetracyclo[10.2.2.02,7.09,14]hexadeca-2,4,6,15-tetraene;hydrochloride |
|---|---|
| PubChem CID | 70590551 |
| Molecular Formula | C19H26ClN |
| Molecular Weight | 303.88 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | (1R)-1-ethyl-10,11-dimethyl-10-azatetracyclo[10.2.2.02,7.09,14]hexadeca-2,4,6,15-tetraene;hydrochloride |
| SMILES | CC[C@@]12C=CC3CC1C(Cc1ccccc12)N(C)C3C.Cl |
| InChI | InChI=1S/C19H25N.ClH/c1-4-19-10-9-14-11-17(19)18(20(3)13(14)2)12-15-7-5-6-8-16(15)19;/h5-10,13-14,17-18H,4,11-12H2,1-3H3;1H/t13?,14?,17?,18?,19-;/m0./s1 |
| InChIKey | LOGHTHMMUVWQCD-VSLRYQBXSA-N |
| XLogP | 4.21 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.88 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|