C5H12NO3S+ — CID 7059078
[(3S,4R)-4-hydroxy-1,1-dioxothiolan-3-yl]-methylazanium (PubChem CID 7059078) has the molecular formula C5H12NO3S+ and a molecular weight of 166.22 g/mol. Its IUPAC name is [(3S,4R)-4-hydroxy-1,1-dioxothiolan-3-yl]-methylazanium.
| Compound Name | [(3S,4R)-4-hydroxy-1,1-dioxothiolan-3-yl]-methylazanium |
|---|---|
| PubChem CID | 7059078 |
| Molecular Formula | C5H12NO3S+ |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.05 |
| IUPAC Name | [(3S,4R)-4-hydroxy-1,1-dioxothiolan-3-yl]-methylazanium |
| SMILES | C[NH2+][C@@H]1CS(=O)(=O)C[C@@H]1O |
| InChI | InChI=1S/C5H11NO3S/c1-6-4-2-10(8,9)3-5(4)7/h4-7H,2-3H2,1H3/p+1/t4-,5+/m1/s1 |
| InChIKey | AZDGOTPNJUNJNK-UHNVWZDZSA-O |
| XLogP | -2.66 |
| TPSA | 70.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | -2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |