About 2-(2-bromomorpholin-4-yl)-7-chloro-4H-1,3-benzoxazine
2-(2-bromomorpholin-4-yl)-7-chloro-4H-1,3-benzoxazine (PubChem CID 70590786) has the molecular formula C12H12BrClN2O2
and a molecular weight of 331.60 g/mol. Its IUPAC name is 2-(2-bromomorpholin-4-yl)-7-chloro-4H-1,3-benzoxazine.
Molecular Properties
| Compound Name | 2-(2-bromomorpholin-4-yl)-7-chloro-4H-1,3-benzoxazine |
| PubChem CID | 70590786 |
| Molecular Formula | C12H12BrClN2O2 |
| Molecular Weight | 331.60 g/mol |
| Exact Mass | 329.98 |
| IUPAC Name | 2-(2-bromomorpholin-4-yl)-7-chloro-4H-1,3-benzoxazine |
| SMILES | Clc1ccc2c(c1)OC(N1CCOC(Br)C1)=NC2 |
| InChI | InChI=1S/C12H12BrClN2O2/c13-11-7-16(3-4-17-11)12-15-6-8-1-2-9(14)5-10(8)18-12/h1-2,5,11H,3-4,6-7H2 |
| InChIKey | NZDJAQQNMPOSJY-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.60 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-bromomorpholin-4-yl)-7-chloro-4H-1,3-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-bromomorpholin-4-yl)-7-chloro-4H-1,3-benzoxazine?
The IUPAC name of 2-(2-bromomorpholin-4-yl)-7-chloro-4H-1,3-benzoxazine (CID 70590786) is 2-(2-bromomorpholin-4-yl)-7-chloro-4H-1,3-benzoxazine.
What is the SMILES notation for 2-(2-bromomorpholin-4-yl)-7-chloro-4H-1,3-benzoxazine?
The canonical SMILES for 2-(2-bromomorpholin-4-yl)-7-chloro-4H-1,3-benzoxazine is Clc1ccc2c(c1)OC(N1CCOC(Br)C1)=NC2.
What is the InChIKey of 2-(2-bromomorpholin-4-yl)-7-chloro-4H-1,3-benzoxazine?
The InChIKey is NZDJAQQNMPOSJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12BrClN2O2/c13-11-7-16(3-4-17-11)12-15-6-8-1-2-9(14)5-10(8)18-12/h1-2,5,11H,3-4,6-7H2.
What are the key properties of 2-(2-bromomorpholin-4-yl)-7-chloro-4H-1,3-benzoxazine?
2-(2-bromomorpholin-4-yl)-7-chloro-4H-1,3-benzoxazine has a molecular weight of 331.60 g/mol, XLogP of 2.64, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-bromomorpholin-4-yl)-7-chloro-4H-1,3-benzoxazine is sourced from PubChem (CID 70590786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).