C8H13ClO4 — CID 70591162
2-[(1R,2S,3R,5R)-5-chloro-3-hydroxy-2-(hydroxymethyl)cyclopentyl]acetic acid (PubChem CID 70591162) has the molecular formula C8H13ClO4 and a molecular weight of 208.64 g/mol. Its IUPAC name is 2-[(1R,2S,3R,5R)-5-chloro-3-hydroxy-2-(hydroxymethyl)cyclopentyl]acetic acid.
| Compound Name | 2-[(1R,2S,3R,5R)-5-chloro-3-hydroxy-2-(hydroxymethyl)cyclopentyl]acetic acid |
|---|---|
| PubChem CID | 70591162 |
| Molecular Formula | C8H13ClO4 |
| Molecular Weight | 208.64 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | 2-[(1R,2S,3R,5R)-5-chloro-3-hydroxy-2-(hydroxymethyl)cyclopentyl]acetic acid |
| SMILES | O=C(O)C[C@@H]1[C@@H](CO)[C@H](O)C[C@H]1Cl |
| InChI | InChI=1S/C8H13ClO4/c9-6-2-7(11)5(3-10)4(6)1-8(12)13/h4-7,10-11H,1-3H2,(H,12,13)/t4-,5-,6-,7-/m1/s1 |
| InChIKey | PFGCSXRIQAOXCS-DBRKOABJSA-N |
| XLogP | 0.06 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.64 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|