About [4-[3-(4-chlorophenyl)propylamino]phenyl] pent-2-ynoate
[4-[3-(4-chlorophenyl)propylamino]phenyl] pent-2-ynoate (PubChem CID 70591220) has the molecular formula C20H20ClNO2
and a molecular weight of 341.84 g/mol. Its IUPAC name is [4-[3-(4-chlorophenyl)propylamino]phenyl] pent-2-ynoate.
Molecular Properties
| Compound Name | [4-[3-(4-chlorophenyl)propylamino]phenyl] pent-2-ynoate |
| PubChem CID | 70591220 |
| Molecular Formula | C20H20ClNO2 |
| Molecular Weight | 341.84 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | [4-[3-(4-chlorophenyl)propylamino]phenyl] pent-2-ynoate |
| SMILES | CCC#CC(=O)Oc1ccc(NCCCc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C20H20ClNO2/c1-2-3-6-20(23)24-19-13-11-18(12-14-19)22-15-4-5-16-7-9-17(21)10-8-16/h7-14,22H,2,4-5,15H2,1H3 |
| InChIKey | VRKOVDREHCVHJY-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.84 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [4-[3-(4-chlorophenyl)propylamino]phenyl] pent-2-ynoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[3-(4-chlorophenyl)propylamino]phenyl] pent-2-ynoate?
The IUPAC name of [4-[3-(4-chlorophenyl)propylamino]phenyl] pent-2-ynoate (CID 70591220) is [4-[3-(4-chlorophenyl)propylamino]phenyl] pent-2-ynoate.
What is the SMILES notation for [4-[3-(4-chlorophenyl)propylamino]phenyl] pent-2-ynoate?
The canonical SMILES for [4-[3-(4-chlorophenyl)propylamino]phenyl] pent-2-ynoate is CCC#CC(=O)Oc1ccc(NCCCc2ccc(Cl)cc2)cc1.
What is the InChIKey of [4-[3-(4-chlorophenyl)propylamino]phenyl] pent-2-ynoate?
The InChIKey is VRKOVDREHCVHJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20ClNO2/c1-2-3-6-20(23)24-19-13-11-18(12-14-19)22-15-4-5-16-7-9-17(21)10-8-16/h7-14,22H,2,4-5,15H2,1H3.
What are the key properties of [4-[3-(4-chlorophenyl)propylamino]phenyl] pent-2-ynoate?
[4-[3-(4-chlorophenyl)propylamino]phenyl] pent-2-ynoate has a molecular weight of 341.84 g/mol, XLogP of 4.70, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[3-(4-chlorophenyl)propylamino]phenyl] pent-2-ynoate is sourced from PubChem (CID 70591220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).