C13H22N2 — CID 70591221
N-methyl-3-(6-methyl-2,3,6,7-tetrahydro-1H-indol-7-yl)propan-1-amine (PubChem CID 70591221) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is N-methyl-3-(6-methyl-2,3,6,7-tetrahydro-1H-indol-7-yl)propan-1-amine.
| Compound Name | N-methyl-3-(6-methyl-2,3,6,7-tetrahydro-1H-indol-7-yl)propan-1-amine |
|---|---|
| PubChem CID | 70591221 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | N-methyl-3-(6-methyl-2,3,6,7-tetrahydro-1H-indol-7-yl)propan-1-amine |
| SMILES | CNCCCC1C2=C(C=CC1C)CCN2 |
| InChI | InChI=1S/C13H22N2/c1-10-5-6-11-7-9-15-13(11)12(10)4-3-8-14-2/h5-6,10,12,14-15H,3-4,7-9H2,1-2H3 |
| InChIKey | XQOOIDBLGQYQQV-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|