C33H51N3O4 — CID 70591318
bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-benzyl-2-(2-cyanoethyl)propanedioate (PubChem CID 70591318) has the molecular formula C33H51N3O4 and a molecular weight of 553.79 g/mol. Its IUPAC name is bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-benzyl-2-(2-cyanoethyl)propanedioate.
| Compound Name | bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-benzyl-2-(2-cyanoethyl)propanedioate |
|---|---|
| PubChem CID | 70591318 |
| Molecular Formula | C33H51N3O4 |
| Molecular Weight | 553.79 g/mol |
| Exact Mass | 553.39 |
| IUPAC Name | bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-benzyl-2-(2-cyanoethyl)propanedioate |
| SMILES | CN1C(C)(C)CC(OC(=O)C(CCC#N)(Cc2ccccc2)C(=O)OC2CC(C)(C)N(C)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C33H51N3O4/c1-29(2)20-25(21-30(3,4)35(29)9)39-27(37)33(17-14-18-34,19-24-15-12-11-13-16-24)28(38)40-26-22-31(5,6)36(10)32(7,8)23-26/h11-13,15-16,25-26H,14,17,19-23H2,1-10H3 |
| InChIKey | SNXPXNNXYHBOQL-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 82.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.79 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|