C19H23I2N3 — CID 70591359
N-[(4-iodophenyl)-phenylmethyl]-1-methyl-4,5,6,7-tetrahydro-1,3-diazepin-2-amine;hydroiodide (PubChem CID 70591359) has the molecular formula C19H23I2N3 and a molecular weight of 547.22 g/mol. Its IUPAC name is N-[(4-iodophenyl)-phenylmethyl]-1-methyl-4,5,6,7-tetrahydro-1,3-diazepin-2-amine;hydroiodide.
| Compound Name | N-[(4-iodophenyl)-phenylmethyl]-1-methyl-4,5,6,7-tetrahydro-1,3-diazepin-2-amine;hydroiodide |
|---|---|
| PubChem CID | 70591359 |
| Molecular Formula | C19H23I2N3 |
| Molecular Weight | 547.22 g/mol |
| Exact Mass | 547.00 |
| IUPAC Name | N-[(4-iodophenyl)-phenylmethyl]-1-methyl-4,5,6,7-tetrahydro-1,3-diazepin-2-amine;hydroiodide |
| SMILES | CN1CCCCN=C1NC(c1ccccc1)c1ccc(I)cc1.I |
| InChI | InChI=1S/C19H22IN3.HI/c1-23-14-6-5-13-21-19(23)22-18(15-7-3-2-4-8-15)16-9-11-17(20)12-10-16;/h2-4,7-12,18H,5-6,13-14H2,1H3,(H,21,22);1H |
| InChIKey | GUWWBUGDAPBZRQ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.22 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|