About sodium;cyclohex-4-ene-1,2-dicarboxylate;hydron
sodium;cyclohex-4-ene-1,2-dicarboxylate;hydron (PubChem CID 70591363) has the molecular formula C8H9NaO4
and a molecular weight of 192.15 g/mol. Its IUPAC name is sodium;cyclohex-4-ene-1,2-dicarboxylate;hydron.
Molecular Properties
| Compound Name | sodium;cyclohex-4-ene-1,2-dicarboxylate;hydron |
| PubChem CID | 70591363 |
| Molecular Formula | C8H9NaO4 |
| Molecular Weight | 192.15 g/mol |
| Exact Mass | 192.04 |
| IUPAC Name | sodium;cyclohex-4-ene-1,2-dicarboxylate;hydron |
| SMILES | O=C([O-])C1CC=CCC1C(=O)[O-].[H+].[Na+] |
| InChI | InChI=1S/C8H10O4.Na/c9-7(10)5-3-1-2-4-6(5)8(11)12;/h1-2,5-6H,3-4H2,(H,9,10)(H,11,12);/q;+1/p-1 |
| InChIKey | DSQJWWZJQSSRHV-UHFFFAOYSA-M |
| XLogP | -4.81 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.15 |
| LogP ≤ 5 | -4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze sodium;cyclohex-4-ene-1,2-dicarboxylate;hydron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;cyclohex-4-ene-1,2-dicarboxylate;hydron?
The IUPAC name of sodium;cyclohex-4-ene-1,2-dicarboxylate;hydron (CID 70591363) is sodium;cyclohex-4-ene-1,2-dicarboxylate;hydron.
What is the SMILES notation for sodium;cyclohex-4-ene-1,2-dicarboxylate;hydron?
The canonical SMILES for sodium;cyclohex-4-ene-1,2-dicarboxylate;hydron is O=C([O-])C1CC=CCC1C(=O)[O-].[H+].[Na+].
What is the InChIKey of sodium;cyclohex-4-ene-1,2-dicarboxylate;hydron?
The InChIKey is DSQJWWZJQSSRHV-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H10O4.Na/c9-7(10)5-3-1-2-4-6(5)8(11)12;/h1-2,5-6H,3-4H2,(H,9,10)(H,11,12);/q;+1/p-1.
What are the key properties of sodium;cyclohex-4-ene-1,2-dicarboxylate;hydron?
sodium;cyclohex-4-ene-1,2-dicarboxylate;hydron has a molecular weight of 192.15 g/mol, XLogP of -4.81, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;cyclohex-4-ene-1,2-dicarboxylate;hydron is sourced from PubChem (CID 70591363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).