C11H22N2 — CID 70591427
trans-(1S,2S)-1-N,2-N-dimethyl-2-N-prop-2-enylcyclohexane-1,2-diamine (PubChem CID 70591427) has the molecular formula C11H22N2 and a molecular weight of 182.31 g/mol. Its IUPAC name is trans-(1S,2S)-1-N,2-N-dimethyl-2-N-prop-2-enylcyclohexane-1,2-diamine.
| Compound Name | trans-(1S,2S)-1-N,2-N-dimethyl-2-N-prop-2-enylcyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 70591427 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | trans-(1S,2S)-1-N,2-N-dimethyl-2-N-prop-2-enylcyclohexane-1,2-diamine |
| SMILES | C=CCN(C)[C@H]1CCCC[C@@H]1NC |
| InChI | InChI=1S/C11H22N2/c1-4-9-13(3)11-8-6-5-7-10(11)12-2/h4,10-12H,1,5-9H2,2-3H3/t10-,11-/m0/s1 |
| InChIKey | MIMIUTJGEKNPLP-QWRGUYRKSA-N |
| XLogP | 1.63 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|