C22H29FO6S — CID 70591789
7-[(1S,2R)-2-[3-(4-fluorophenoxy)-2-hydroxy-2-methylpropyl]sulfanyl-3-hydroxy-5-oxocyclopentyl]hept-2-enoic acid (PubChem CID 70591789) has the molecular formula C22H29FO6S and a molecular weight of 440.53 g/mol. Its IUPAC name is 7-[(1S,2R)-2-[3-(4-fluorophenoxy)-2-hydroxy-2-methylpropyl]sulfanyl-3-hydroxy-5-oxocyclopentyl]hept-2-enoic acid.
| Compound Name | 7-[(1S,2R)-2-[3-(4-fluorophenoxy)-2-hydroxy-2-methylpropyl]sulfanyl-3-hydroxy-5-oxocyclopentyl]hept-2-enoic acid |
|---|---|
| PubChem CID | 70591789 |
| Molecular Formula | C22H29FO6S |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | 7-[(1S,2R)-2-[3-(4-fluorophenoxy)-2-hydroxy-2-methylpropyl]sulfanyl-3-hydroxy-5-oxocyclopentyl]hept-2-enoic acid |
| SMILES | CC(O)(COc1ccc(F)cc1)CS[C@H]1C(O)CC(=O)[C@@H]1CCCCC=CC(=O)O |
| InChI | InChI=1S/C22H29FO6S/c1-22(28,13-29-16-10-8-15(23)9-11-16)14-30-21-17(18(24)12-19(21)25)6-4-2-3-5-7-20(26)27/h5,7-11,17,19,21,25,28H,2-4,6,12-14H2,1H3,(H,26,27)/t17-,19?,21+,22?/m0/s1 |
| InChIKey | JXYRGASGPGZIFW-UCBFXACNSA-N |
| XLogP | 3.21 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|