C13H12N4+2 — CID 70591840
16,17-diaza-7,10-diazoniatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),2,4,6,10,12,14-heptaene (PubChem CID 70591840) has the molecular formula C13H12N4+2 and a molecular weight of 224.27 g/mol. Its IUPAC name is 16,17-diaza-7,10-diazoniatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),2,4,6,10,12,14-heptaene.
| Compound Name | 16,17-diaza-7,10-diazoniatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),2,4,6,10,12,14-heptaene |
|---|---|
| PubChem CID | 70591840 |
| Molecular Formula | C13H12N4+2 |
| Molecular Weight | 224.27 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 16,17-diaza-7,10-diazoniatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),2,4,6,10,12,14-heptaene |
| SMILES | c1cc[n+]2c(c1)-c1nn3ccccc3[n+]1CC2 |
| InChI | InChI=1S/C13H12N4/c1-3-7-15-9-10-16-12-6-2-4-8-17(12)14-13(16)11(15)5-1/h1-8H,9-10H2/q+2 |
| InChIKey | FGFJOXCUBBAOLV-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 25.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.27 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|