C18H25F3O3 — CID 70591846
(3aR,4R,6aR)-6a-methyl-4-[4-methyl-3-oxo-4-(trifluoromethyl)oct-1-enyl]-3a,4,5,6-tetrahydro-3H-cyclopenta[b]furan-2-one (PubChem CID 70591846) has the molecular formula C18H25F3O3 and a molecular weight of 346.39 g/mol. Its IUPAC name is (3aR,4R,6aR)-6a-methyl-4-[4-methyl-3-oxo-4-(trifluoromethyl)oct-1-enyl]-3a,4,5,6-tetrahydro-3H-cyclopenta[b]furan-2-one.
| Compound Name | (3aR,4R,6aR)-6a-methyl-4-[4-methyl-3-oxo-4-(trifluoromethyl)oct-1-enyl]-3a,4,5,6-tetrahydro-3H-cyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 70591846 |
| Molecular Formula | C18H25F3O3 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | (3aR,4R,6aR)-6a-methyl-4-[4-methyl-3-oxo-4-(trifluoromethyl)oct-1-enyl]-3a,4,5,6-tetrahydro-3H-cyclopenta[b]furan-2-one |
| SMILES | CCCCC(C)(C(=O)C=C[C@H]1CC[C@@]2(C)OC(=O)C[C@H]12)C(F)(F)F |
| InChI | InChI=1S/C18H25F3O3/c1-4-5-9-16(2,18(19,20)21)14(22)7-6-12-8-10-17(3)13(12)11-15(23)24-17/h6-7,12-13H,4-5,8-11H2,1-3H3/t12-,13+,16?,17+/m0/s1 |
| InChIKey | VSJPBGGCZLYXFN-HTCUUYGLSA-N |
| XLogP | 4.60 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|