About 2-chloro-5,6-dimethoxy-1,3-benzothiazole
2-chloro-5,6-dimethoxy-1,3-benzothiazole (PubChem CID 7059202) has the molecular formula C9H8ClNO2S
and a molecular weight of 229.69 g/mol. Its IUPAC name is 2-chloro-5,6-dimethoxy-1,3-benzothiazole.
Molecular Properties
| Compound Name | 2-chloro-5,6-dimethoxy-1,3-benzothiazole |
| PubChem CID | 7059202 |
| Molecular Formula | C9H8ClNO2S |
| Molecular Weight | 229.69 g/mol |
| Exact Mass | 229.00 |
| IUPAC Name | 2-chloro-5,6-dimethoxy-1,3-benzothiazole |
| SMILES | COc1cc2nc(Cl)sc2cc1OC |
| InChI | InChI=1S/C9H8ClNO2S/c1-12-6-3-5-8(4-7(6)13-2)14-9(10)11-5/h3-4H,1-2H3 |
| InChIKey | VQLUSLHALUKRLE-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.69 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-chloro-5,6-dimethoxy-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5,6-dimethoxy-1,3-benzothiazole?
The IUPAC name of 2-chloro-5,6-dimethoxy-1,3-benzothiazole (CID 7059202) is 2-chloro-5,6-dimethoxy-1,3-benzothiazole.
What is the SMILES notation for 2-chloro-5,6-dimethoxy-1,3-benzothiazole?
The canonical SMILES for 2-chloro-5,6-dimethoxy-1,3-benzothiazole is COc1cc2nc(Cl)sc2cc1OC.
What is the InChIKey of 2-chloro-5,6-dimethoxy-1,3-benzothiazole?
The InChIKey is VQLUSLHALUKRLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8ClNO2S/c1-12-6-3-5-8(4-7(6)13-2)14-9(10)11-5/h3-4H,1-2H3.
What are the key properties of 2-chloro-5,6-dimethoxy-1,3-benzothiazole?
2-chloro-5,6-dimethoxy-1,3-benzothiazole has a molecular weight of 229.69 g/mol, XLogP of 2.97, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5,6-dimethoxy-1,3-benzothiazole is sourced from PubChem (CID 7059202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).