About 1-ethyl-1'-[4-(4-fluorophenyl)-4-hydroxybutyl]spiro[indole-3,4'-piperidine]-2-one
1-ethyl-1'-[4-(4-fluorophenyl)-4-hydroxybutyl]spiro[indole-3,4'-piperidine]-2-one (PubChem CID 70592105) has the molecular formula C24H29FN2O2
and a molecular weight of 396.51 g/mol. Its IUPAC name is 1-ethyl-1'-[4-(4-fluorophenyl)-4-hydroxybutyl]spiro[indole-3,4'-piperidine]-2-one.
Molecular Properties
| Compound Name | 1-ethyl-1'-[4-(4-fluorophenyl)-4-hydroxybutyl]spiro[indole-3,4'-piperidine]-2-one |
| PubChem CID | 70592105 |
| Molecular Formula | C24H29FN2O2 |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | 1-ethyl-1'-[4-(4-fluorophenyl)-4-hydroxybutyl]spiro[indole-3,4'-piperidine]-2-one |
| SMILES | CCN1C(=O)C2(CCN(CCCC(O)c3ccc(F)cc3)CC2)c2ccccc21 |
| InChI | InChI=1S/C24H29FN2O2/c1-2-27-21-7-4-3-6-20(21)24(23(27)29)13-16-26(17-14-24)15-5-8-22(28)18-9-11-19(25)12-10-18/h3-4,6-7,9-12,22,28H,2,5,8,13-17H2,1H3 |
| InChIKey | SDMFQXUZACPOEB-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-ethyl-1'-[4-(4-fluorophenyl)-4-hydroxybutyl]spiro[indole-3,4'-piperidine]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-1'-[4-(4-fluorophenyl)-4-hydroxybutyl]spiro[indole-3,4'-piperidine]-2-one?
The IUPAC name of 1-ethyl-1'-[4-(4-fluorophenyl)-4-hydroxybutyl]spiro[indole-3,4'-piperidine]-2-one (CID 70592105) is 1-ethyl-1'-[4-(4-fluorophenyl)-4-hydroxybutyl]spiro[indole-3,4'-piperidine]-2-one.
What is the SMILES notation for 1-ethyl-1'-[4-(4-fluorophenyl)-4-hydroxybutyl]spiro[indole-3,4'-piperidine]-2-one?
The canonical SMILES for 1-ethyl-1'-[4-(4-fluorophenyl)-4-hydroxybutyl]spiro[indole-3,4'-piperidine]-2-one is CCN1C(=O)C2(CCN(CCCC(O)c3ccc(F)cc3)CC2)c2ccccc21.
What is the InChIKey of 1-ethyl-1'-[4-(4-fluorophenyl)-4-hydroxybutyl]spiro[indole-3,4'-piperidine]-2-one?
The InChIKey is SDMFQXUZACPOEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H29FN2O2/c1-2-27-21-7-4-3-6-20(21)24(23(27)29)13-16-26(17-14-24)15-5-8-22(28)18-9-11-19(25)12-10-18/h3-4,6-7,9-12,22,28H,2,5,8,13-17H2,1H3.
What are the key properties of 1-ethyl-1'-[4-(4-fluorophenyl)-4-hydroxybutyl]spiro[indole-3,4'-piperidine]-2-one?
1-ethyl-1'-[4-(4-fluorophenyl)-4-hydroxybutyl]spiro[indole-3,4'-piperidine]-2-one has a molecular weight of 396.51 g/mol, XLogP of 4.04, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-1'-[4-(4-fluorophenyl)-4-hydroxybutyl]spiro[indole-3,4'-piperidine]-2-one is sourced from PubChem (CID 70592105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).