C12H20N2 — CID 70592184
N-methyl-3-(2,3,6,7-tetrahydro-1H-indol-7-yl)propan-1-amine (PubChem CID 70592184) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is N-methyl-3-(2,3,6,7-tetrahydro-1H-indol-7-yl)propan-1-amine.
| Compound Name | N-methyl-3-(2,3,6,7-tetrahydro-1H-indol-7-yl)propan-1-amine |
|---|---|
| PubChem CID | 70592184 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | N-methyl-3-(2,3,6,7-tetrahydro-1H-indol-7-yl)propan-1-amine |
| SMILES | CNCCCC1CC=CC2=C1NCC2 |
| InChI | InChI=1S/C12H20N2/c1-13-8-3-6-10-4-2-5-11-7-9-14-12(10)11/h2,5,10,13-14H,3-4,6-9H2,1H3 |
| InChIKey | MNVQXUQXWBUKLF-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|