C25H42O5 — CID 70592332
ethyl 7-[(1R,2S)-2-[2-(5-butyl-2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]-5-oxocyclopentyl]hept-2-enoate (PubChem CID 70592332) has the molecular formula C25H42O5 and a molecular weight of 422.61 g/mol. Its IUPAC name is ethyl 7-[(1R,2S)-2-[2-(5-butyl-2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]-5-oxocyclopentyl]hept-2-enoate.
| Compound Name | ethyl 7-[(1R,2S)-2-[2-(5-butyl-2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]-5-oxocyclopentyl]hept-2-enoate |
|---|---|
| PubChem CID | 70592332 |
| Molecular Formula | C25H42O5 |
| Molecular Weight | 422.61 g/mol |
| Exact Mass | 422.30 |
| IUPAC Name | ethyl 7-[(1R,2S)-2-[2-(5-butyl-2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]-5-oxocyclopentyl]hept-2-enoate |
| SMILES | CCCCC1OC(C)(C)OC1CC[C@H]1CCC(=O)[C@@H]1CCCCC=CC(=O)OCC |
| InChI | InChI=1S/C25H42O5/c1-5-7-13-22-23(30-25(3,4)29-22)18-16-19-15-17-21(26)20(19)12-10-8-9-11-14-24(27)28-6-2/h11,14,19-20,22-23H,5-10,12-13,15-18H2,1-4H3/t19-,20-,22?,23?/m1/s1 |
| InChIKey | MIPGHYMMVINVRW-FDIHYXAFSA-N |
| XLogP | 5.75 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.61 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|