C10H18N4 — CID 70592392
1-N-(3,6-dimethylpyrazin-2-yl)-1-N',1-N'-dimethylethane-1,1-diamine (PubChem CID 70592392) has the molecular formula C10H18N4 and a molecular weight of 194.28 g/mol. Its IUPAC name is 1-N-(3,6-dimethylpyrazin-2-yl)-1-N',1-N'-dimethylethane-1,1-diamine.
| Compound Name | 1-N-(3,6-dimethylpyrazin-2-yl)-1-N',1-N'-dimethylethane-1,1-diamine |
|---|---|
| PubChem CID | 70592392 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | 1-N-(3,6-dimethylpyrazin-2-yl)-1-N',1-N'-dimethylethane-1,1-diamine |
| SMILES | Cc1cnc(C)c(NC(C)N(C)C)n1 |
| InChI | InChI=1S/C10H18N4/c1-7-6-11-8(2)10(12-7)13-9(3)14(4)5/h6,9H,1-5H3,(H,12,13) |
| InChIKey | HHXWLPSUXWZKDH-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|