C12H15ClN2O3S — CID 70592744
2-chloro-5-(4-propyl-4,5-dihydro-1,3-oxazol-2-yl)benzenesulfonamide (PubChem CID 70592744) has the molecular formula C12H15ClN2O3S and a molecular weight of 302.78 g/mol. Its IUPAC name is 2-chloro-5-(4-propyl-4,5-dihydro-1,3-oxazol-2-yl)benzenesulfonamide.
| Compound Name | 2-chloro-5-(4-propyl-4,5-dihydro-1,3-oxazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 70592744 |
| Molecular Formula | C12H15ClN2O3S |
| Molecular Weight | 302.78 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 2-chloro-5-(4-propyl-4,5-dihydro-1,3-oxazol-2-yl)benzenesulfonamide |
| SMILES | CCCC1COC(c2ccc(Cl)c(S(N)(=O)=O)c2)=N1 |
| InChI | InChI=1S/C12H15ClN2O3S/c1-2-3-9-7-18-12(15-9)8-4-5-10(13)11(6-8)19(14,16)17/h4-6,9H,2-3,7H2,1H3,(H2,14,16,17) |
| InChIKey | GWKQKVIQZDZGOD-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.78 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |