C7H14O3 — CID 70592812
(2S,4R,5S)-2-ethyl-4-methyl-1,3-dioxan-5-ol (PubChem CID 70592812) has the molecular formula C7H14O3 and a molecular weight of 146.19 g/mol. Its IUPAC name is (2S,4R,5S)-2-ethyl-4-methyl-1,3-dioxan-5-ol.
| Compound Name | (2S,4R,5S)-2-ethyl-4-methyl-1,3-dioxan-5-ol |
|---|---|
| PubChem CID | 70592812 |
| Molecular Formula | C7H14O3 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.09 |
| IUPAC Name | (2S,4R,5S)-2-ethyl-4-methyl-1,3-dioxan-5-ol |
| SMILES | CC[C@H]1OC[C@H](O)[C@@H](C)O1 |
| InChI | InChI=1S/C7H14O3/c1-3-7-9-4-6(8)5(2)10-7/h5-8H,3-4H2,1-2H3/t5-,6+,7+/m1/s1 |
| InChIKey | NMUSGZLGOXSCIX-VQVTYTSYSA-N |
| XLogP | 0.52 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |