C13H14ClN3OS — CID 70592905
(Z)-1-(5-chlorothiophen-2-yl)-4,4-dimethyl-2-(1,2,4-triazol-1-yl)pent-1-en-3-one (PubChem CID 70592905) has the molecular formula C13H14ClN3OS and a molecular weight of 295.80 g/mol. Its IUPAC name is (Z)-1-(5-chlorothiophen-2-yl)-4,4-dimethyl-2-(1,2,4-triazol-1-yl)pent-1-en-3-one.
| Compound Name | (Z)-1-(5-chlorothiophen-2-yl)-4,4-dimethyl-2-(1,2,4-triazol-1-yl)pent-1-en-3-one |
|---|---|
| PubChem CID | 70592905 |
| Molecular Formula | C13H14ClN3OS |
| Molecular Weight | 295.80 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | (Z)-1-(5-chlorothiophen-2-yl)-4,4-dimethyl-2-(1,2,4-triazol-1-yl)pent-1-en-3-one |
| SMILES | CC(C)(C)C(=O)/C(=C/c1ccc(Cl)s1)n1cncn1 |
| InChI | InChI=1S/C13H14ClN3OS/c1-13(2,3)12(18)10(17-8-15-7-16-17)6-9-4-5-11(14)19-9/h4-8H,1-3H3/b10-6- |
| InChIKey | ZLQPFDJZMXNIRC-POHAHGRESA-N |
| XLogP | 3.61 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.80 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|