C11H13ClN2O — CID 7059302
N-(5-chloro-2-methoxyphenyl)-3,4-dihydro-2H-pyrrol-5-amine (PubChem CID 7059302) has the molecular formula C11H13ClN2O and a molecular weight of 224.69 g/mol. Its IUPAC name is N-(5-chloro-2-methoxyphenyl)-3,4-dihydro-2H-pyrrol-5-amine.
| Compound Name | N-(5-chloro-2-methoxyphenyl)-3,4-dihydro-2H-pyrrol-5-amine |
|---|---|
| PubChem CID | 7059302 |
| Molecular Formula | C11H13ClN2O |
| Molecular Weight | 224.69 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | N-(5-chloro-2-methoxyphenyl)-3,4-dihydro-2H-pyrrol-5-amine |
| SMILES | COc1ccc(Cl)cc1NC1=NCCC1 |
| InChI | InChI=1S/C11H13ClN2O/c1-15-10-5-4-8(12)7-9(10)14-11-3-2-6-13-11/h4-5,7H,2-3,6H2,1H3,(H,13,14) |
| InChIKey | OJLZPPLLDCAHNR-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.69 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |