About methyl 2-acetyloxy-7-[(1R,2R)-2-(4-methyl-4-propoxypent-1-enyl)-5-oxocyclopentyl]hept-2-enoate
methyl 2-acetyloxy-7-[(1R,2R)-2-(4-methyl-4-propoxypent-1-enyl)-5-oxocyclopentyl]hept-2-enoate (PubChem CID 70593091) has the molecular formula C24H38O6
and a molecular weight of 422.56 g/mol. Its IUPAC name is methyl 2-acetyloxy-7-[(1R,2R)-2-(4-methyl-4-propoxypent-1-enyl)-5-oxocyclopentyl]hept-2-enoate.
Molecular Properties
| Compound Name | methyl 2-acetyloxy-7-[(1R,2R)-2-(4-methyl-4-propoxypent-1-enyl)-5-oxocyclopentyl]hept-2-enoate |
| PubChem CID | 70593091 |
| Molecular Formula | C24H38O6 |
| Molecular Weight | 422.56 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | methyl 2-acetyloxy-7-[(1R,2R)-2-(4-methyl-4-propoxypent-1-enyl)-5-oxocyclopentyl]hept-2-enoate |
| SMILES | CCCOC(C)(C)CC=C[C@H]1CCC(=O)[C@@H]1CCCCC=C(OC(C)=O)C(=O)OC |
| InChI | InChI=1S/C24H38O6/c1-6-17-29-24(3,4)16-10-11-19-14-15-21(26)20(19)12-8-7-9-13-22(23(27)28-5)30-18(2)25/h10-11,13,19-20H,6-9,12,14-17H2,1-5H3/t19-,20+/m0/s1 |
| InChIKey | CXGCMPFWGZKVSF-VQTJNVASSA-N |
| XLogP | 4.91 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.56 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-acetyloxy-7-[(1R,2R)-2-(4-methyl-4-propoxypent-1-enyl)-5-oxocyclopentyl]hept-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-acetyloxy-7-[(1R,2R)-2-(4-methyl-4-propoxypent-1-enyl)-5-oxocyclopentyl]hept-2-enoate?
The IUPAC name of methyl 2-acetyloxy-7-[(1R,2R)-2-(4-methyl-4-propoxypent-1-enyl)-5-oxocyclopentyl]hept-2-enoate (CID 70593091) is methyl 2-acetyloxy-7-[(1R,2R)-2-(4-methyl-4-propoxypent-1-enyl)-5-oxocyclopentyl]hept-2-enoate.
What is the SMILES notation for methyl 2-acetyloxy-7-[(1R,2R)-2-(4-methyl-4-propoxypent-1-enyl)-5-oxocyclopentyl]hept-2-enoate?
The canonical SMILES for methyl 2-acetyloxy-7-[(1R,2R)-2-(4-methyl-4-propoxypent-1-enyl)-5-oxocyclopentyl]hept-2-enoate is CCCOC(C)(C)CC=C[C@H]1CCC(=O)[C@@H]1CCCCC=C(OC(C)=O)C(=O)OC.
What is the InChIKey of methyl 2-acetyloxy-7-[(1R,2R)-2-(4-methyl-4-propoxypent-1-enyl)-5-oxocyclopentyl]hept-2-enoate?
The InChIKey is CXGCMPFWGZKVSF-VQTJNVASSA-N. The full InChI is InChI=1S/C24H38O6/c1-6-17-29-24(3,4)16-10-11-19-14-15-21(26)20(19)12-8-7-9-13-22(23(27)28-5)30-18(2)25/h10-11,13,19-20H,6-9,12,14-17H2,1-5H3/t19-,20+/m0/s1.
What are the key properties of methyl 2-acetyloxy-7-[(1R,2R)-2-(4-methyl-4-propoxypent-1-enyl)-5-oxocyclopentyl]hept-2-enoate?
methyl 2-acetyloxy-7-[(1R,2R)-2-(4-methyl-4-propoxypent-1-enyl)-5-oxocyclopentyl]hept-2-enoate has a molecular weight of 422.56 g/mol, XLogP of 4.91, 13 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-acetyloxy-7-[(1R,2R)-2-(4-methyl-4-propoxypent-1-enyl)-5-oxocyclopentyl]hept-2-enoate is sourced from PubChem (CID 70593091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).