C29H50O6 — CID 70593294
[3-(acetyloxymethyl)-7,11,15-trimethyl-12-(oxan-2-yloxy)hexadeca-2,14-dienyl] acetate (PubChem CID 70593294) has the molecular formula C29H50O6 and a molecular weight of 494.71 g/mol. Its IUPAC name is [3-(acetyloxymethyl)-7,11,15-trimethyl-12-(oxan-2-yloxy)hexadeca-2,14-dienyl] acetate.
| Compound Name | [3-(acetyloxymethyl)-7,11,15-trimethyl-12-(oxan-2-yloxy)hexadeca-2,14-dienyl] acetate |
|---|---|
| PubChem CID | 70593294 |
| Molecular Formula | C29H50O6 |
| Molecular Weight | 494.71 g/mol |
| Exact Mass | 494.36 |
| IUPAC Name | [3-(acetyloxymethyl)-7,11,15-trimethyl-12-(oxan-2-yloxy)hexadeca-2,14-dienyl] acetate |
| SMILES | CC(=O)OCC=C(CCCC(C)CCCC(C)C(CC=C(C)C)OC1CCCCO1)COC(C)=O |
| InChI | InChI=1S/C29H50O6/c1-22(2)16-17-28(35-29-15-7-8-19-33-29)24(4)13-9-11-23(3)12-10-14-27(21-34-26(6)31)18-20-32-25(5)30/h16,18,23-24,28-29H,7-15,17,19-21H2,1-6H3 |
| InChIKey | IDUGXYBPTPUVRZ-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.71 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|