C25H46O5 — CID 70593383
3-(hydroxymethyl)-7,11,15-trimethyl-12-(oxan-2-yloxy)hexadeca-2,14-diene-1,7-diol (PubChem CID 70593383) has the molecular formula C25H46O5 and a molecular weight of 426.64 g/mol. Its IUPAC name is 3-(hydroxymethyl)-7,11,15-trimethyl-12-(oxan-2-yloxy)hexadeca-2,14-diene-1,7-diol.
| Compound Name | 3-(hydroxymethyl)-7,11,15-trimethyl-12-(oxan-2-yloxy)hexadeca-2,14-diene-1,7-diol |
|---|---|
| PubChem CID | 70593383 |
| Molecular Formula | C25H46O5 |
| Molecular Weight | 426.64 g/mol |
| Exact Mass | 426.33 |
| IUPAC Name | 3-(hydroxymethyl)-7,11,15-trimethyl-12-(oxan-2-yloxy)hexadeca-2,14-diene-1,7-diol |
| SMILES | CC(C)=CCC(OC1CCCCO1)C(C)CCCC(C)(O)CCCC(=CCO)CO |
| InChI | InChI=1S/C25H46O5/c1-20(2)12-13-23(30-24-11-5-6-18-29-24)21(3)9-7-15-25(4,28)16-8-10-22(19-27)14-17-26/h12,14,21,23-24,26-28H,5-11,13,15-19H2,1-4H3 |
| InChIKey | CAMGBNLOGTUEEZ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.64 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|