C15H25N3O4 — CID 70593591
ethyl 7,7,8,9,9-pentamethyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decane-3-carboxylate (PubChem CID 70593591) has the molecular formula C15H25N3O4 and a molecular weight of 311.38 g/mol. Its IUPAC name is ethyl 7,7,8,9,9-pentamethyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decane-3-carboxylate.
| Compound Name | ethyl 7,7,8,9,9-pentamethyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decane-3-carboxylate |
|---|---|
| PubChem CID | 70593591 |
| Molecular Formula | C15H25N3O4 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.18 |
| IUPAC Name | ethyl 7,7,8,9,9-pentamethyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decane-3-carboxylate |
| SMILES | CCOC(=O)N1C(=O)NC2(CC(C)(C)N(C)C(C)(C)C2)C1=O |
| InChI | InChI=1S/C15H25N3O4/c1-7-22-12(21)18-10(19)15(16-11(18)20)8-13(2,3)17(6)14(4,5)9-15/h7-9H2,1-6H3,(H,16,20) |
| InChIKey | MMPKVTWJIMDRDA-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|