C16H25N3O3 — CID 70593626
8-[(E)-but-2-enoyl]-3,7,7,9,9-pentamethyl-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 70593626) has the molecular formula C16H25N3O3 and a molecular weight of 307.39 g/mol. Its IUPAC name is 8-[(E)-but-2-enoyl]-3,7,7,9,9-pentamethyl-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-[(E)-but-2-enoyl]-3,7,7,9,9-pentamethyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 70593626 |
| Molecular Formula | C16H25N3O3 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | 8-[(E)-but-2-enoyl]-3,7,7,9,9-pentamethyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | C/C=C/C(=O)N1C(C)(C)CC2(CC1(C)C)NC(=O)N(C)C2=O |
| InChI | InChI=1S/C16H25N3O3/c1-7-8-11(20)19-14(2,3)9-16(10-15(19,4)5)12(21)18(6)13(22)17-16/h7-8H,9-10H2,1-6H3,(H,17,22)/b8-7+ |
| InChIKey | SDOHFQLUHZJOTM-BQYQJAHWSA-N |
| XLogP | 1.66 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|