About 4-bromo-N-(4,5-dihydro-1H-imidazol-2-yl)-1-methylpyrazol-5-amine;hydrochloride
4-bromo-N-(4,5-dihydro-1H-imidazol-2-yl)-1-methylpyrazol-5-amine;hydrochloride (PubChem CID 70593633) has the molecular formula C7H11BrClN5
and a molecular weight of 280.56 g/mol. Its IUPAC name is 4-bromo-N-(4,5-dihydro-1H-imidazol-2-yl)-1-methylpyrazol-5-amine;hydrochloride.
Molecular Properties
| Compound Name | 4-bromo-N-(4,5-dihydro-1H-imidazol-2-yl)-1-methylpyrazol-5-amine;hydrochloride |
| PubChem CID | 70593633 |
| Molecular Formula | C7H11BrClN5 |
| Molecular Weight | 280.56 g/mol |
| Exact Mass | 278.99 |
| IUPAC Name | 4-bromo-N-(4,5-dihydro-1H-imidazol-2-yl)-1-methylpyrazol-5-amine;hydrochloride |
| SMILES | Cl.Cn1ncc(Br)c1NC1=NCCN1 |
| InChI | InChI=1S/C7H10BrN5.ClH/c1-13-6(5(8)4-11-13)12-7-9-2-3-10-7;/h4H,2-3H2,1H3,(H2,9,10,12);1H |
| InChIKey | PAUSYZOMZMEFFC-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.56 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-bromo-N-(4,5-dihydro-1H-imidazol-2-yl)-1-methylpyrazol-5-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-N-(4,5-dihydro-1H-imidazol-2-yl)-1-methylpyrazol-5-amine;hydrochloride?
The IUPAC name of 4-bromo-N-(4,5-dihydro-1H-imidazol-2-yl)-1-methylpyrazol-5-amine;hydrochloride (CID 70593633) is 4-bromo-N-(4,5-dihydro-1H-imidazol-2-yl)-1-methylpyrazol-5-amine;hydrochloride.
What is the SMILES notation for 4-bromo-N-(4,5-dihydro-1H-imidazol-2-yl)-1-methylpyrazol-5-amine;hydrochloride?
The canonical SMILES for 4-bromo-N-(4,5-dihydro-1H-imidazol-2-yl)-1-methylpyrazol-5-amine;hydrochloride is Cl.Cn1ncc(Br)c1NC1=NCCN1.
What is the InChIKey of 4-bromo-N-(4,5-dihydro-1H-imidazol-2-yl)-1-methylpyrazol-5-amine;hydrochloride?
The InChIKey is PAUSYZOMZMEFFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10BrN5.ClH/c1-13-6(5(8)4-11-13)12-7-9-2-3-10-7;/h4H,2-3H2,1H3,(H2,9,10,12);1H.
What are the key properties of 4-bromo-N-(4,5-dihydro-1H-imidazol-2-yl)-1-methylpyrazol-5-amine;hydrochloride?
4-bromo-N-(4,5-dihydro-1H-imidazol-2-yl)-1-methylpyrazol-5-amine;hydrochloride has a molecular weight of 280.56 g/mol, XLogP of 0.98, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-N-(4,5-dihydro-1H-imidazol-2-yl)-1-methylpyrazol-5-amine;hydrochloride is sourced from PubChem (CID 70593633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).