C11H15NNaO3 — CID 70594097
CID 70594097 (PubChem CID 70594097) has the molecular formula C11H15NNaO3 and a molecular weight of 232.23 g/mol.
| Compound Name | CID 70594097 |
|---|---|
| PubChem CID | 70594097 |
| Molecular Formula | C11H15NNaO3 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | — |
| SMILES | CCOc1cc(CCN)ccc1C(=O)O.[Na] |
| InChI | InChI=1S/C11H15NO3.Na/c1-2-15-10-7-8(5-6-12)3-4-9(10)11(13)14;/h3-4,7H,2,5-6,12H2,1H3,(H,13,14); |
| InChIKey | VCCPPGGFPNSMJP-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |