About dibutyl (Z)-but-2-enedioate;pyrrolidin-2-one
dibutyl (Z)-but-2-enedioate;pyrrolidin-2-one (PubChem CID 70594302) has the molecular formula C16H27NO5
and a molecular weight of 313.39 g/mol. Its IUPAC name is dibutyl (Z)-but-2-enedioate;pyrrolidin-2-one.
Molecular Properties
| Compound Name | dibutyl (Z)-but-2-enedioate;pyrrolidin-2-one |
| PubChem CID | 70594302 |
| Molecular Formula | C16H27NO5 |
| Molecular Weight | 313.39 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | dibutyl (Z)-but-2-enedioate;pyrrolidin-2-one |
| SMILES | CCCCOC(=O)/C=C\C(=O)OCCCC.O=C1CCCN1 |
| InChI | InChI=1S/C12H20O4.C4H7NO/c1-3-5-9-15-11(13)7-8-12(14)16-10-6-4-2;6-4-2-1-3-5-4/h7-8H,3-6,9-10H2,1-2H3;1-3H2,(H,5,6)/b8-7-; |
| InChIKey | YVUCLQQAKBPZHY-CFYXSCKTSA-N |
| XLogP | 2.13 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.39 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze dibutyl (Z)-but-2-enedioate;pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibutyl (Z)-but-2-enedioate;pyrrolidin-2-one?
The IUPAC name of dibutyl (Z)-but-2-enedioate;pyrrolidin-2-one (CID 70594302) is dibutyl (Z)-but-2-enedioate;pyrrolidin-2-one.
What is the SMILES notation for dibutyl (Z)-but-2-enedioate;pyrrolidin-2-one?
The canonical SMILES for dibutyl (Z)-but-2-enedioate;pyrrolidin-2-one is CCCCOC(=O)/C=C\C(=O)OCCCC.O=C1CCCN1.
What is the InChIKey of dibutyl (Z)-but-2-enedioate;pyrrolidin-2-one?
The InChIKey is YVUCLQQAKBPZHY-CFYXSCKTSA-N. The full InChI is InChI=1S/C12H20O4.C4H7NO/c1-3-5-9-15-11(13)7-8-12(14)16-10-6-4-2;6-4-2-1-3-5-4/h7-8H,3-6,9-10H2,1-2H3;1-3H2,(H,5,6)/b8-7-;.
What are the key properties of dibutyl (Z)-but-2-enedioate;pyrrolidin-2-one?
dibutyl (Z)-but-2-enedioate;pyrrolidin-2-one has a molecular weight of 313.39 g/mol, XLogP of 2.13, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dibutyl (Z)-but-2-enedioate;pyrrolidin-2-one is sourced from PubChem (CID 70594302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).