C7H10O2 — CID 7059435
(1R,2S)-3-methylcyclohexa-3,5-diene-1,2-diol (PubChem CID 7059435) has the molecular formula C7H10O2 and a molecular weight of 126.15 g/mol. Its IUPAC name is (1R,2S)-3-methylcyclohexa-3,5-diene-1,2-diol.
| Compound Name | (1R,2S)-3-methylcyclohexa-3,5-diene-1,2-diol |
|---|---|
| PubChem CID | 7059435 |
| Molecular Formula | C7H10O2 |
| Molecular Weight | 126.15 g/mol |
| Exact Mass | 126.07 |
| IUPAC Name | (1R,2S)-3-methylcyclohexa-3,5-diene-1,2-diol |
| SMILES | CC1=CC=C[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C7H10O2/c1-5-3-2-4-6(8)7(5)9/h2-4,6-9H,1H3/t6-,7+/m1/s1 |
| InChIKey | FTZZKLFGNQOODA-RQJHMYQMSA-N |
| XLogP | 0.22 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.15 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |